Difference between revisions of "SJ12994"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * common-name: ** prephytoene diphosphate * smiles: ** cc(=cccc(=cccc(=cccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketopimeloyl-ACP-methyl-esters 3-Ketopimeloyl-ACP-methyl-esters] == * common-name: ** a 3-oxo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketopimeloyl-ACP-methyl-esters 3-Ketopimeloyl-ACP-methyl-esters] ==
 
* common-name:
 
* common-name:
** prephytoene diphosphate
+
** a 3-oxo-pimeloyl-[acp] methyl ester
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c
 
* inchi-key:
 
** rvcnktpchznaao-imslgmfesa-k
 
* molecular-weight:
 
** 719.897
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXNARA-8002]]
+
* [[RXN-11480]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.5.1.32-RXN]]
+
* [[RXN-11479]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=prephytoene diphosphate}}
+
{{#set: common-name=a 3-oxo-pimeloyl-[acp] methyl ester}}
{{#set: inchi-key=inchikey=rvcnktpchznaao-imslgmfesa-k}}
 
{{#set: molecular-weight=719.897}}
 

Revision as of 14:20, 26 August 2019

Metabolite 3-Ketopimeloyl-ACP-methyl-esters

  • common-name:
    • a 3-oxo-pimeloyl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 3-oxo-pimeloyl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.