Difference between revisions of "SJ13054"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-PYR OH-PYR] == * common-name: ** hydroxypyruvate * smiles: ** c(c(=o)c([o-])=o)o * inchi-key...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12128 CPD-12128] == * common-name: ** menaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12128 CPD-12128] == |
* common-name: | * common-name: | ||
| − | ** | + | ** menaquinol-11 |
* smiles: | * smiles: | ||
| − | ** c(c(=o)c( | + | ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zxhqkrgmwkzwgn-ryzszpjesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 923.499 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9362]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menaquinol-11}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zxhqkrgmwkzwgn-ryzszpjesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=923.499}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-12128
- common-name:
- menaquinol-11
- smiles:
- cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
- inchi-key:
- zxhqkrgmwkzwgn-ryzszpjesa-n
- molecular-weight:
- 923.499
