Difference between revisions of "SJ13173"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9406 CPD-9406] == * common-name: ** (2s)-ethylmalonyl-coa * smiles: ** ccc(c(sccnc(=o)ccnc(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galacto...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dlgjwsvwtwewbj-ztvljyeesa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 378.312 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12178]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dlgjwsvwtwewbj-ztvljyeesa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=378.312}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-36
- common-name:
- 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine
- smiles:
- cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
- inchi-key:
- dlgjwsvwtwewbj-ztvljyeesa-m
- molecular-weight:
- 378.312
