Difference between revisions of "SJ13196"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * common-name: ** oxalosuccinate * smiles: ** c(c([o-])=o)c...")
(Created page with "Category:gene == Gene SJ13196 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * POLYNUCLEOTIDE-ADENYLYLT...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] ==
+
== Gene SJ13196 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** oxalosuccinate
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
+
* [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** ufscuaxltrfidc-uhfffaoysa-k
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
** 187.085
+
{{#set: nb reaction associated=1}}
== Reaction(s) known to consume the compound ==
 
* [[RXN-8642]]
 
* [[RXN-9951]]
 
== Reaction(s) known to produce the compound ==
 
* [[RXN-8642]]
 
* [[RXN-9951]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=oxalosuccinate}}
 
{{#set: inchi-key=inchikey=ufscuaxltrfidc-uhfffaoysa-k}}
 
{{#set: molecular-weight=187.085}}
 

Latest revision as of 11:02, 18 March 2021

Gene SJ13196

Organism(s) associated with this gene

Reaction(s) associated