Difference between revisions of "SJ13196"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * common-name: ** oxalosuccinate * smiles: ** c(c([o-])=o)c...")
(Created page with "Category:gene == Gene SJ03349 == * transcription-direction: ** positive * right-end-position: ** 57227 * left-end-position: ** 51925 * centisome-position: ** 42.460545...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] ==
+
== Gene SJ03349 ==
* common-name:
+
* transcription-direction:
** oxalosuccinate
+
** positive
* smiles:
+
* right-end-position:
** c(c([o-])=o)c(c(c(=o)[o-])=o)c([o-])=o
+
** 57227
* inchi-key:
+
* left-end-position:
** ufscuaxltrfidc-uhfffaoysa-k
+
** 51925
* molecular-weight:
+
* centisome-position:
** 187.085
+
** 42.460545   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-8642]]
+
* [[S.japonica_sterols_curated]]
* [[RXN-9951]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[2.7.10.1-RXN]]
* [[RXN-8642]]
+
** Category: [[annotation]]
* [[RXN-9951]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
* [[2.7.12.1-RXN]]
{{#set: common-name=oxalosuccinate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=ufscuaxltrfidc-uhfffaoysa-k}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=187.085}}
+
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=57227}}
 +
{{#set: left-end-position=51925}}
 +
{{#set: centisome-position=42.460545    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=4}}

Revision as of 20:20, 18 December 2020

Gene SJ03349

  • transcription-direction:
    • positive
  • right-end-position:
    • 57227
  • left-end-position:
    • 51925
  • centisome-position:
    • 42.460545

Organism(s) associated with this gene

Reaction(s) associated