Difference between revisions of "SJ13227"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYLNEURAMINATE N-ACETYLNEURAMINATE] == * common-name: ** n-acetylneuraminate == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == * common-name: ** anthranilate * smiles: ** c(c1(c(=cc=cc=1)n))(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ANTHRANILATE ANTHRANILATE] == |
* common-name: | * common-name: | ||
| − | ** n- | + | ** anthranilate |
| + | * smiles: | ||
| + | ** c(c1(c(=cc=cc=1)n))(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** rwzyaggxghygmb-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 136.13 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ANTHRANSYN-RXN]] |
| − | * [[RXN | + | * [[PRTRANS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ANTHRANSYN-RXN]] |
| − | * [[RXN | + | * [[PRTRANS-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=anthranilate}} |
| + | {{#set: inchi-key=inchikey=rwzyaggxghygmb-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=136.13}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite ANTHRANILATE
- common-name:
- anthranilate
- smiles:
- c(c1(c(=cc=cc=1)n))(=o)[o-]
- inchi-key:
- rwzyaggxghygmb-uhfffaoysa-m
- molecular-weight:
- 136.13
