Difference between revisions of "SJ13268"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-941 CPD-941] == * common-name: ** s-(2-methylbutanoyl)-dihydrolipoamide * smiles: ** ccc(c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-tRNAfmet L-methionyl-tRNAfmet] == * common-name: ** an l-methionyl-[initiator trnam...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-941 CPD-941] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-tRNAfmet L-methionyl-tRNAfmet] ==
 
* common-name:
 
* common-name:
** s-(2-methylbutanoyl)-dihydrolipoamide
+
** an l-methionyl-[initiator trnamet]
* smiles:
 
** ccc(c(sccc(ccccc(n)=o)s)=o)c
 
* inchi-key:
 
** ufncwfssegpjnl-uhfffaoysa-n
 
* molecular-weight:
 
** 291.466
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DHRT_LPAREN_2mbcoa_RPAREN_]]
+
* [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16165]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-(2-methylbutanoyl)-dihydrolipoamide}}
+
{{#set: common-name=an l-methionyl-[initiator trnamet]}}
{{#set: inchi-key=inchikey=ufncwfssegpjnl-uhfffaoysa-n}}
 
{{#set: molecular-weight=291.466}}
 

Revision as of 14:20, 26 August 2019

Metabolite L-methionyl-tRNAfmet

  • common-name:
    • an l-methionyl-[initiator trnamet]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-methionyl-[initiator trnamet" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.