Difference between revisions of "SJ13292"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * common-name: ** 6-hydroxymelatonin * smiles: ** cc(=o)nccc1(=cnc2(c1=...")
(Created page with "Category:gene == Gene SJ16651 == * transcription-direction: ** positive * right-end-position: ** 48549 * left-end-position: ** 37758 * centisome-position: ** 13.570836...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] ==
+
== Gene SJ16651 ==
* common-name:
+
* transcription-direction:
** 6-hydroxymelatonin
+
** positive
* smiles:
+
* right-end-position:
** cc(=o)nccc1(=cnc2(c1=cc(oc)=c(o)c=2))
+
** 48549
* inchi-key:
+
* left-end-position:
** omymrcxojjzyke-uhfffaoysa-n
+
** 37758
* molecular-weight:
+
* centisome-position:
** 248.281
+
** 13.570836   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-11058]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-11056]]
+
* [[3.1.3.16-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=6-hydroxymelatonin}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=omymrcxojjzyke-uhfffaoysa-n}}
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
{{#set: molecular-weight=248.281}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=48549}}
 +
{{#set: left-end-position=37758}}
 +
{{#set: centisome-position=13.570836    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}

Revision as of 20:20, 18 December 2020

Gene SJ16651

  • transcription-direction:
    • positive
  • right-end-position:
    • 48549
  • left-end-position:
    • 37758
  • centisome-position:
    • 13.570836

Organism(s) associated with this gene

Reaction(s) associated