Difference between revisions of "SJ13312"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFATE SULFATE] == * common-name: ** sulfate * smiles: ** o=s(=o)([o-])[o-] * inchi-key: ** qa...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * common-name: ** α,α-trehalose 6-phosphate * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == |
* common-name: | * common-name: | ||
| − | ** | + | ** α,α-trehalose 6-phosphate |
* smiles: | * smiles: | ||
| − | ** o | + | ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** labspybhmpdtel-lizsdcnhsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 420.263 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TREHALOSEPHOSPHA-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[TREHALOSE6PSYN-RXN]] |
| − | * [[ | + | * [[UG6PGT]] |
| − | + | * [[UG6PGTn]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α,α-trehalose 6-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=labspybhmpdtel-lizsdcnhsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=420.263}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite TREHALOSE-6P
- common-name:
- α,α-trehalose 6-phosphate
- smiles:
- c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o
- inchi-key:
- labspybhmpdtel-lizsdcnhsa-l
- molecular-weight:
- 420.263
