Difference between revisions of "SJ13364"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] == * common-name: ** fadh2 * smiles: ** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)...")
(Created page with "Category:gene == Gene SJ13364 == * transcription-direction: ** positive * right-end-position: ** 261969 * left-end-position: ** 235860 * centisome-position: ** 69.66935...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] ==
+
== Gene SJ13364 ==
* common-name:
+
* transcription-direction:
** fadh2
+
** positive
* smiles:
+
* right-end-position:
** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
+
** 261969
* inchi-key:
+
* left-end-position:
** ypzrhbjkemoyqh-uybvjogssa-l
+
** 235860
* molecular-weight:
+
* centisome-position:
** 785.556
+
** 69.66935   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ACOAD1f]]
+
* [[S.japonica_carotenoid_curated]]
* [[PPCOAOm]]
+
== Reaction(s) associated ==
* [[RXN-14264]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[ACOA120OR]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ACOA140OR]]
+
** Category: [[orthology]]
* [[ACOA160OR]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[ACOA40OR]]
+
{{#set: transcription-direction=positive}}
* [[ACOA80OR]]
+
{{#set: right-end-position=261969}}
* [[ACOAD1f]]
+
{{#set: left-end-position=235860}}
* [[IVCDH]]
+
{{#set: centisome-position=69.66935    }}
* [[MCDH]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
+
{{#set: nb reaction associated=1}}
* [[PPCOAOm]]
 
* [[RXN-14264]]
 
* [[SUCDHm]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=fadh2}}
 
{{#set: inchi-key=inchikey=ypzrhbjkemoyqh-uybvjogssa-l}}
 
{{#set: molecular-weight=785.556}}
 

Latest revision as of 11:02, 18 March 2021

Gene SJ13364

  • transcription-direction:
    • positive
  • right-end-position:
    • 261969
  • left-end-position:
    • 235860
  • centisome-position:
    • 69.66935

Organism(s) associated with this gene

Reaction(s) associated