Difference between revisions of "SJ13434"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] == * common-name: ** nω-phosphocreatine * smiles: ** c(c(=o)[o-])n...")
(Created page with "Category:gene == Gene SJ13434 == * transcription-direction: ** negative * right-end-position: ** 71956 * left-end-position: ** 67728 * centisome-position: ** 20.108847...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE-P CREATINE-P] ==
+
== Gene SJ13434 ==
* common-name:
+
* transcription-direction:
** nω-phosphocreatine
+
** negative
* smiles:
+
* right-end-position:
** c(c(=o)[o-])n(c)c(np(=o)([o-])[o-])=[n+]
+
** 71956
* inchi-key:
+
* left-end-position:
** drbbfclwyrjsjz-uhfffaoysa-l
+
** 67728
* molecular-weight:
+
* centisome-position:
** 209.098
+
** 20.108847   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[CREATINE-KINASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[CREATINE-KINASE-RXN]]
+
* [[RXN-12894]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=nω-phosphocreatine}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=drbbfclwyrjsjz-uhfffaoysa-l}}
+
* [[RXN-12895]]
{{#set: molecular-weight=209.098}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-12896]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN0-6460]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY0-1471]]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=71956}}
 +
{{#set: left-end-position=67728}}
 +
{{#set: centisome-position=20.108847    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ13434

  • transcription-direction:
    • negative
  • right-end-position:
    • 71956
  • left-end-position:
    • 67728
  • centisome-position:
    • 20.108847

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY0-1471
    • 1 reactions found over 6 reactions in the full pathway