Difference between revisions of "SJ13453"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] == * common-name: ** l-threonine 3-o-phosp...")
(Created page with "Category:gene == Gene SJ13453 == * transcription-direction: ** negative * right-end-position: ** 512168 * left-end-position: ** 502284 * centisome-position: ** 68.939186...")
 
(8 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] ==
+
== Gene SJ13453 ==
* common-name:
+
* transcription-direction:
** l-threonine 3-o-phosphate
+
** negative
* smiles:
+
* right-end-position:
** cc(op([o-])([o-])=o)c([n+])c([o-])=o
+
** 512168
* inchi-key:
+
* left-end-position:
** usrgiujoyoxoqj-gbxijsldsa-l
+
** 502284
* molecular-weight:
+
* centisome-position:
** 197.084
+
** 68.939186   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[4.1.1.81-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[RXN-11841]]
{{#set: common-name=l-threonine 3-o-phosphate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=usrgiujoyoxoqj-gbxijsldsa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=197.084}}
+
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=512168}}
 +
{{#set: left-end-position=502284}}
 +
{{#set: centisome-position=68.939186    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ13453

  • transcription-direction:
    • negative
  • right-end-position:
    • 512168
  • left-end-position:
    • 502284
  • centisome-position:
    • 68.939186

Organism(s) associated with this gene

Reaction(s) associated