Difference between revisions of "SJ13453"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] == * common-name: ** l-threonine 3-o-phosp...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] == * common-name: ** acryloyl-coa * smiles: ** c=cc(=o)sccnc(=o)ccnc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] ==
 
* common-name:
 
* common-name:
** l-threonine 3-o-phosphate
+
** acryloyl-coa
 
* smiles:
 
* smiles:
** cc(op([o-])([o-])=o)c([n+])c([o-])=o
+
** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** usrgiujoyoxoqj-gbxijsldsa-l
+
** poodsgumucvrtr-iexphmlfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 197.084
+
** 817.551
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.1.1.81-RXN]]
+
* [[PPCOAOm]]
 +
* [[RXN-6383]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PPCOAOm]]
 +
* [[RXN-6383]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-threonine 3-o-phosphate}}
+
{{#set: common-name=acryloyl-coa}}
{{#set: inchi-key=inchikey=usrgiujoyoxoqj-gbxijsldsa-l}}
+
{{#set: inchi-key=inchikey=poodsgumucvrtr-iexphmlfsa-j}}
{{#set: molecular-weight=197.084}}
+
{{#set: molecular-weight=817.551}}

Revision as of 09:24, 27 August 2019

Metabolite ACRYLYL-COA

  • common-name:
    • acryloyl-coa
  • smiles:
    • c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • poodsgumucvrtr-iexphmlfsa-j
  • molecular-weight:
    • 817.551

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality