Difference between revisions of "SJ13463"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13397 CPD-13397] == * common-name: ** l-alanyl-l-threonine * smiles: ** cc([n+])c(=o)nc(c(o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13610 CPD-13610] == * common-name: ** 3-dehydrosphinganine (c20) * smiles: ** ccccccccccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13397 CPD-13397] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13610 CPD-13610] ==
 
* common-name:
 
* common-name:
** l-alanyl-l-threonine
+
** 3-dehydrosphinganine (c20)
 
* smiles:
 
* smiles:
** cc([n+])c(=o)nc(c(o)c)c([o-])=o
+
** cccccccccccccccccc(=o)c([n+])co
 
* inchi-key:
 
* inchi-key:
** buqichwnxbibog-lmvfsukvsa-n
+
** fvolnxkbislpqy-ibgzpjmesa-o
 
* molecular-weight:
 
* molecular-weight:
** 190.199
+
** 328.557
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6980]]
+
* [[RXN-12642]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12642]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-alanyl-l-threonine}}
+
{{#set: common-name=3-dehydrosphinganine (c20)}}
{{#set: inchi-key=inchikey=buqichwnxbibog-lmvfsukvsa-n}}
+
{{#set: inchi-key=inchikey=fvolnxkbislpqy-ibgzpjmesa-o}}
{{#set: molecular-weight=190.199}}
+
{{#set: molecular-weight=328.557}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-13610

  • common-name:
    • 3-dehydrosphinganine (c20)
  • smiles:
    • cccccccccccccccccc(=o)c([n+])co
  • inchi-key:
    • fvolnxkbislpqy-ibgzpjmesa-o
  • molecular-weight:
    • 328.557

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality