Difference between revisions of "SJ13468"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15839 CPD-15839] == * common-name: ** δ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=His-tRNA-2-O-MeAdenosine4 His-tRNA-2-O-MeAdenosine4] == * common-name: ** a 2'-o-methyladenosin...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15839 CPD-15839] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=His-tRNA-2-O-MeAdenosine4 His-tRNA-2-O-MeAdenosine4] ==
 
* common-name:
 
* common-name:
** δ-tocotrienol
+
** a 2'-o-methyladenosine4 in trnahis
* smiles:
 
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c
 
* inchi-key:
 
** odadklylwwchnb-ldybvbfysa-n
 
* molecular-weight:
 
** 396.612
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14919]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12479]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=δ-tocotrienol}}
+
{{#set: common-name=a 2'-o-methyladenosine4 in trnahis}}
{{#set: inchi-key=inchikey=odadklylwwchnb-ldybvbfysa-n}}
 
{{#set: molecular-weight=396.612}}
 

Revision as of 09:24, 27 August 2019

Metabolite His-tRNA-2-O-MeAdenosine4

  • common-name:
    • a 2'-o-methyladenosine4 in trnahis

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality