Difference between revisions of "SJ13507"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-D-GLUCOSE DTDP-D-GLUCOSE] == * common-name: ** dtdp-α-d-glucose * smiles: ** cc1(=cn...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9858 CPD-9858] == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-D-GLUCOSE DTDP-D-GLUCOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9858 CPD-9858] ==
 
* common-name:
 
* common-name:
** dtdp-α-d-glucose
+
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
 
* smiles:
 
* smiles:
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(co)c(o)c(o)c(o)2))o3))
+
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** ysykrgrsmltjnl-urarbognsa-l
+
** wegxyvfdoluulo-tuumqracsa-n
 
* molecular-weight:
 
* molecular-weight:
** 562.317
+
** 616.966
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DTDPGLUCDEHYDRAT-RXN]]
+
* [[RXN-9227]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtdp-α-d-glucose}}
+
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
{{#set: inchi-key=inchikey=ysykrgrsmltjnl-urarbognsa-l}}
+
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
{{#set: molecular-weight=562.317}}
+
{{#set: molecular-weight=616.966}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-9858

  • common-name:
    • 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
  • smiles:
    • cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
  • inchi-key:
    • wegxyvfdoluulo-tuumqracsa-n
  • molecular-weight:
    • 616.966

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality