Difference between revisions of "SJ13513"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] == * common-name: ** 2,4-dihydroxyhept-2-enedioate * smiles: ** c(=o)([o-]...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Linoleoyl-L-Phosphatidate 1-Linoleoyl-L-Phosphatidate] == * common-name: ** a 1-linoleoyl 2-a...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15125 CPD-15125] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Linoleoyl-L-Phosphatidate 1-Linoleoyl-L-Phosphatidate] ==
 
* common-name:
 
* common-name:
** 2,4-dihydroxyhept-2-enedioate
+
** a 1-linoleoyl 2-acyl-sn-glycerol 3-phosphate
* smiles:
 
** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-]
 
* inchi-key:
 
** apnidhdqyiszae-hyxafxhysa-l
 
* molecular-weight:
 
** 188.137
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14146]]
+
* [[RXN-16071]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14146]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,4-dihydroxyhept-2-enedioate}}
+
{{#set: common-name=a 1-linoleoyl 2-acyl-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=apnidhdqyiszae-hyxafxhysa-l}}
 
{{#set: molecular-weight=188.137}}
 

Revision as of 09:25, 27 August 2019

Metabolite 1-Linoleoyl-L-Phosphatidate

  • common-name:
    • a 1-linoleoyl 2-acyl-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality