Difference between revisions of "SJ13521"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-HIS-tRNAs Charged-HIS-tRNAs] == * common-name: ** an l-histidyl-[trnahis] == Reaction(s...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-HYDROXYMETHYLGLUTATHIONE S-HYDROXYMETHYLGLUTATHIONE] == * common-name: ** s-(hydroxymethyl)gl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-HIS-tRNAs Charged-HIS-tRNAs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-HYDROXYMETHYLGLUTATHIONE S-HYDROXYMETHYLGLUTATHIONE] ==
 
* common-name:
 
* common-name:
** an l-histidyl-[trnahis]
+
** s-(hydroxymethyl)glutathione
 +
* smiles:
 +
** c(nc(=o)c(csco)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
 +
* inchi-key:
 +
** piuslwsyoyfrfr-bqbzgakwsa-m
 +
* molecular-weight:
 +
** 336.339
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-2962]]
 +
* [[RXN0-276]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTIDINE--TRNA-LIGASE-RXN]]
+
* [[RXN0-276]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-histidyl-[trnahis]}}
+
{{#set: common-name=s-(hydroxymethyl)glutathione}}
 +
{{#set: inchi-key=inchikey=piuslwsyoyfrfr-bqbzgakwsa-m}}
 +
{{#set: molecular-weight=336.339}}

Revision as of 09:23, 27 August 2019

Metabolite S-HYDROXYMETHYLGLUTATHIONE

  • common-name:
    • s-(hydroxymethyl)glutathione
  • smiles:
    • c(nc(=o)c(csco)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
  • inchi-key:
    • piuslwsyoyfrfr-bqbzgakwsa-m
  • molecular-weight:
    • 336.339

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality