Difference between revisions of "SJ13526"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] == * common-name: ** (3z)-dodec-3-enoyl-coa * smiles: ** ccccccccc=ccc(sccnc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] == * common-name: ** gibberellin a53 * smiles: ** c=c1(c2(o)(cc3(c1)(c([ch]4(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] ==
 
* common-name:
 
* common-name:
** (3z)-dodec-3-enoyl-coa
+
** gibberellin a53
 
* smiles:
 
* smiles:
** ccccccccc=ccc(sccnc(ccnc(c(c(cop(op(occ3(c(op(=o)([o-])[o-])c(o)c(n2(c1(n=cn=c(n)c=1n=c2)))o3))(=o)[o-])(=o)[o-])(c)c)o)=o)=o)=o
+
** c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** xemivmktvgrftd-qxmhvhedsa-j
+
** czemyyicwzpenf-voltxkgxsa-l
 
* molecular-weight:
 
* molecular-weight:
** 943.792
+
** 346.422
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7931]]
+
* [[RXN1F-167]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14394]]
 
* [[RXN-7931]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z)-dodec-3-enoyl-coa}}
+
{{#set: common-name=gibberellin a53}}
{{#set: inchi-key=inchikey=xemivmktvgrftd-qxmhvhedsa-j}}
+
{{#set: inchi-key=inchikey=czemyyicwzpenf-voltxkgxsa-l}}
{{#set: molecular-weight=943.792}}
+
{{#set: molecular-weight=346.422}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-695

  • common-name:
    • gibberellin a53
  • smiles:
    • c=c1(c2(o)(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
  • inchi-key:
    • czemyyicwzpenf-voltxkgxsa-l
  • molecular-weight:
    • 346.422

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality