Difference between revisions of "SJ13640"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] == * common-name: ** n-acetyl-l-glutamate * smiles: ** cc(=o)nc(c([o-])=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Adenine-37-tRNA-Alas Adenine-37-tRNA-Alas] == * common-name: ** an adenine37 in trnaala == Reac...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Adenine-37-tRNA-Alas Adenine-37-tRNA-Alas] ==
 
* common-name:
 
* common-name:
** n-acetyl-l-glutamate
+
** an adenine37 in trnaala
* smiles:
 
** cc(=o)nc(c([o-])=o)ccc(=o)[o-]
 
* inchi-key:
 
** rfmmmvdnipukgg-yfkpbyrvsa-l
 
* molecular-weight:
 
** 187.152
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[RXN-13996]]
* [[AGK]]
 
* [[N-ACETYLTRANSFER-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETYLGLUTKIN-RXN]]
+
* [[RXN-13996]]
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 
* [[N-ACETYLTRANSFER-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-l-glutamate}}
+
{{#set: common-name=an adenine37 in trnaala}}
{{#set: inchi-key=inchikey=rfmmmvdnipukgg-yfkpbyrvsa-l}}
 
{{#set: molecular-weight=187.152}}
 

Revision as of 14:20, 26 August 2019

Metabolite Adenine-37-tRNA-Alas

  • common-name:
    • an adenine37 in trnaala

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality