Difference between revisions of "SJ13696"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19759 CPD-19759] == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13853 CPD-13853] == * common-name: ** 8-oxo-dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13853 CPD-13853] == |
+ | * common-name: | ||
+ | ** 8-oxo-dgdp | ||
* smiles: | * smiles: | ||
− | ** c | + | ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) |
− | * | + | * inchi-key: |
− | ** | + | ** ljmltzsnwocynq-vpeninkcsa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 440.179 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12816]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=8-oxo-dgdp}} |
− | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=ljmltzsnwocynq-vpeninkcsa-k}} |
+ | {{#set: molecular-weight=440.179}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-13853
- common-name:
- 8-oxo-dgdp
- smiles:
- c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- ljmltzsnwocynq-vpeninkcsa-k
- molecular-weight:
- 440.179