Difference between revisions of "SJ13703"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] == * common-name: ** squalene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc=c(c)cc...")
(Created page with "Category:gene == Gene SJ13703 == * transcription-direction: ** positive * right-end-position: ** 828899 * left-end-position: ** 809428 * centisome-position: ** 61.079502...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE SQUALENE] ==
+
== Gene SJ13703 ==
* common-name:
+
* transcription-direction:
** squalene
+
** positive
* smiles:
+
* right-end-position:
** cc(c)=cccc(c)=cccc(c)=cccc=c(c)ccc=c(c)ccc=c(c)c
+
** 828899
* inchi-key:
+
* left-end-position:
** yygntywphwgjrm-aajylucbsa-n
+
** 809428
* molecular-weight:
+
* centisome-position:
** 410.725
+
** 61.079502   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[SMO]]
+
* [[S.japonica_carotenoid_curated]]
* [[SQUALENE-MONOOXYGENASE-RXN]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[3.1.3.16-RXN]]
* [[RXN-13162]]
+
** Category: [[annotation]]
* [[RXN-13724]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN66-281]]
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
* [[SMO]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=squalene}}
+
{{#set: transcription-direction=positive}}
{{#set: inchi-key=inchikey=yygntywphwgjrm-aajylucbsa-n}}
+
{{#set: right-end-position=828899}}
{{#set: molecular-weight=410.725}}
+
{{#set: left-end-position=809428}}
 +
{{#set: centisome-position=61.079502    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:00, 18 March 2021

Gene SJ13703

  • transcription-direction:
    • positive
  • right-end-position:
    • 828899
  • left-end-position:
    • 809428
  • centisome-position:
    • 61.079502

Organism(s) associated with this gene

Reaction(s) associated