Difference between revisions of "SJ13724"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13855 CPD-13855] == * common-name: ** n7-methylguanosine 5'-diphosphate * smiles: ** c[n+]1...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == * common-name: ** 3-sulfinoalanine * smiles: ** c(c([n+])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13855 CPD-13855] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] ==
 
* common-name:
 
* common-name:
** n7-methylguanosine 5'-diphosphate
+
** 3-sulfinoalanine
 
* smiles:
 
* smiles:
** c[n+]1(=cn(c2(n=c(n)nc(=o)c1=2))c3(oc(cop(=o)([o-])op([o-])([o-])=o)c(o)c(o)3))
+
** c(c([n+])c(=o)[o-])s([o-])=o
 
* inchi-key:
 
* inchi-key:
** sbasprrecyvbrf-kqynxxcusa-l
+
** advptqaunprnpo-reohclbhsa-m
 
* molecular-weight:
 
* molecular-weight:
** 455.214
+
** 152.145
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12817]]
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12817]]
+
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 +
* [[CYSTEINE-DIOXYGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n7-methylguanosine 5'-diphosphate}}
+
{{#set: common-name=3-sulfinoalanine}}
{{#set: inchi-key=inchikey=sbasprrecyvbrf-kqynxxcusa-l}}
+
{{#set: inchi-key=inchikey=advptqaunprnpo-reohclbhsa-m}}
{{#set: molecular-weight=455.214}}
+
{{#set: molecular-weight=152.145}}

Revision as of 09:24, 27 August 2019

Metabolite 3-SULFINOALANINE

  • common-name:
    • 3-sulfinoalanine
  • smiles:
    • c(c([n+])c(=o)[o-])s([o-])=o
  • inchi-key:
    • advptqaunprnpo-reohclbhsa-m
  • molecular-weight:
    • 152.145

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality