Difference between revisions of "SJ13724"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] == * common-name: ** 3-sulfinoalanine * smiles: ** c(c([n+])...")
(Created page with "Category:gene == Gene SJ13724 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.6.3.6-RXN ** Categor...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINOALANINE 3-SULFINOALANINE] ==
+
== Gene SJ13724 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** 3-sulfinoalanine
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** c(c([n+])c(=o)[o-])s([o-])=o
+
* [[3.6.3.6-RXN]]
* inchi-key:
+
** Category: [[orthology]]
** advptqaunprnpo-reohclbhsa-m
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[ATPASE-RXN]]
** 152.145
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
* [[ATPSYN-RXN]]
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
** Category: [[orthology]]
* [[CYSTEINE-DIOXYGENASE-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
== Pathway(s) associated ==
{{#set: common-name=3-sulfinoalanine}}
+
* [[PWY-7219]]
{{#set: inchi-key=inchikey=advptqaunprnpo-reohclbhsa-m}}
+
** '''4''' reactions found over '''3''' reactions in the full pathway
{{#set: molecular-weight=152.145}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ13724

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7219
    • 4 reactions found over 3 reactions in the full pathway