Difference between revisions of "SJ13758"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-5-ADP 3-5-ADP] == * common-name: ** adenosine 3',5'-bisphosphate * smiles: ** c(c3(c(c(c(n2(c...")
(Created page with "Category:gene == Gene SJ13758 == * transcription-direction: ** negative * right-end-position: ** 129693 * left-end-position: ** 92969 * centisome-position: ** 28.052055...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-5-ADP 3-5-ADP] ==
+
== Gene SJ13758 ==
−
* common-name:
+
* transcription-direction:
−
** adenosine 3',5'-bisphosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)op(=o)([o-])[o-]))op([o-])([o-])=o
+
** 129693
−
* inchi-key:
+
* left-end-position:
−
** whtcpdaxwfldih-kqynxxcusa-j
+
** 92969
−
* molecular-weight:
+
* centisome-position:
−
** 423.172
+
** 28.052055   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[1.8.4.8-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[325-BISPHOSPHATE-NUCLEOTIDASE-RXN]]
+
== Reaction(s) associated ==
−
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
+
* [[ATPASE-RXN]]
−
* [[PAPSPAPthr]]
+
** Category: [[annotation]]
−
* [[RXN-10994]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-15587]]
+
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
−
* [[RXN-15588]]
+
** Category: [[annotation]]
−
* [[RXN-15589]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-16759]]
+
* [[RXN-12195]]
−
* [[RXN-17203]]
+
** Category: [[annotation]]
−
* [[RXN-701]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-12196]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** Category: [[annotation]]
−
* [[1.8.4.8-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[2.8.2.23-RXN]]
+
* [[RXN0-5462]]
−
* [[2.8.2.29-RXN]]
+
** Category: [[annotation]]
−
* [[2.8.2.30-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[ARYL-SULFOTRANSFERASE-RXN]]
+
== Pathway(s) associated ==
−
* [[ARYLAMINE-SULFOTRANSFERASE-RXN]]
+
* [[PWY-6545]]
−
* [[CHONDROITIN-4-SULFOTRANSFERASE-RXN]]
+
** '''8''' reactions found over '''9''' reactions in the full pathway
−
* [[ENTDB-RXN]]
+
* [[PWY-7210]]
−
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
+
** '''8''' reactions found over '''8''' reactions in the full pathway
−
* [[HEPARITIN-SULFOTRANSFERASE-RXN]]
+
* [[PWY-7198]]
−
* [[HOLO-ACP-SYNTH-RXN]]
+
** '''6''' reactions found over '''7''' reactions in the full pathway
−
* [[PAPSPAPthr]]
+
* [[PWY-7184]]
−
* [[RXN-10614]]
+
** '''9''' reactions found over '''9''' reactions in the full pathway
−
* [[RXN-10615]]
+
{{#set: transcription-direction=negative}}
−
* [[RXN-10777]]
+
{{#set: right-end-position=129693}}
−
* [[RXN-10782]]
+
{{#set: left-end-position=92969}}
−
* [[RXN-10994]]
+
{{#set: centisome-position=28.052055    }}
−
* [[RXN-11058]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
* [[RXN-11059]]
+
{{#set: nb reaction associated=5}}
−
* [[RXN-11555]]
+
{{#set: nb pathway associated=4}}
−
* [[RXN-15587]]
 
−
* [[RXN-15588]]
 
−
* [[RXN-15589]]
 
−
* [[RXN-15889]]
 
−
* [[RXN-16759]]
 
−
* [[RXN-17203]]
 
−
* [[RXN-18301]]
 
−
* [[RXN-18303]]
 
−
* [[RXN-701]]
 
−
* [[RXN-7953]]
 
−
* [[RXN-7954]]
 
−
* [[RXN6666-9]]
 
−
</div>
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=adenosine 3',5'-bisphosphate}}
 
−
{{#set: inchi-key=inchikey=whtcpdaxwfldih-kqynxxcusa-j}}
 
−
{{#set: molecular-weight=423.172}}
 

Latest revision as of 11:03, 18 March 2021

Gene SJ13758

  • transcription-direction:
    • negative
  • right-end-position:
    • 129693
  • left-end-position:
    • 92969
  • centisome-position:
    • 28.052055

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6545
    • 8 reactions found over 9 reactions in the full pathway
  • PWY-7210
    • 8 reactions found over 8 reactions in the full pathway
  • PWY-7198
    • 6 reactions found over 7 reactions in the full pathway
  • PWY-7184
    • 9 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ13758&oldid=133151"