Difference between revisions of "SJ13805"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-497 CPD-497] == * common-name: ** pseudouridine * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROPIONYL-COA PROPIONYL-COA] == * common-name: ** propanoyl-coa * smiles: ** ccc(=o)sccnc(=o)cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-497 CPD-497] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROPIONYL-COA PROPIONYL-COA] ==
 
* common-name:
 
* common-name:
** pseudouridine
+
** propanoyl-coa
 
* smiles:
 
* smiles:
** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2))
+
** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ptjwiqphwpfnbw-gbndhiklsa-n
+
** qaqrevbbadehpa-iexphmlfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 244.204
+
** 819.566
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PSEUDOURIDINE-KINASE-RXN]]
+
* [[METHYLACETOACETYLCOATHIOL-RXN]]
* [[RXN-15703]]
+
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[PPCOAOm]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15703]]
+
* [[1.2.1.27-RXN]]
 +
* [[2.3.1.176-RXN]]
 +
* [[ACCAT]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[PPCOAOm]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[RXN-11213]]
 +
* [[RXN-12561]]
 +
* [[RXN-7790]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pseudouridine}}
+
{{#set: common-name=propanoyl-coa}}
{{#set: inchi-key=inchikey=ptjwiqphwpfnbw-gbndhiklsa-n}}
+
{{#set: inchi-key=inchikey=qaqrevbbadehpa-iexphmlfsa-j}}
{{#set: molecular-weight=244.204}}
+
{{#set: molecular-weight=819.566}}

Revision as of 14:20, 26 August 2019

Metabolite PROPIONYL-COA

  • common-name:
    • propanoyl-coa
  • smiles:
    • ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • qaqrevbbadehpa-iexphmlfsa-j
  • molecular-weight:
    • 819.566

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality