Difference between revisions of "SJ13806"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] == * common-name: ** neolinustatin * smiles: ** ccc(oc2(oc(coc1(oc(co)c(o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EIF5A-HYPUSINE EIF5A-HYPUSINE] == * common-name: ** an [eif5a]-hypusine == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14596 CPD-14596] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EIF5A-HYPUSINE EIF5A-HYPUSINE] ==
 
* common-name:
 
* common-name:
** neolinustatin
+
** an [eif5a]-hypusine
* smiles:
 
** ccc(oc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))(c#n)c
 
* inchi-key:
 
** wosyvgndrybqcq-bargltkpsa-n
 
* molecular-weight:
 
** 423.416
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13603]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=neolinustatin}}
+
{{#set: common-name=an [eif5a]-hypusine}}
{{#set: inchi-key=inchikey=wosyvgndrybqcq-bargltkpsa-n}}
 
{{#set: molecular-weight=423.416}}
 

Revision as of 14:20, 26 August 2019

Metabolite EIF5A-HYPUSINE

  • common-name:
    • an [eif5a]-hypusine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [eif5a]-hypusine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.