Difference between revisions of "SJ13884"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NADH NADH] == * common-name: ** nadh * smiles: ** c1(=c(cc=cn1c5(oc(cop(=o)([o-])op(=o)([o-])oc...")
(Created page with "Category:gene == Gene SJ02722 == * transcription-direction: ** positive * right-end-position: ** 500469 * left-end-position: ** 447883 * centisome-position: ** 83.82284...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NADH NADH] ==
+
== Gene SJ02722 ==
* common-name:
+
* transcription-direction:
** nadh
+
** positive
* smiles:
+
* right-end-position:
** c1(=c(cc=cn1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
+
** 500469
* inchi-key:
+
* left-end-position:
** bopgdpnildqyto-nnyoxohssa-l
+
** 447883
* molecular-weight:
+
* centisome-position:
** 663.43
+
** 83.82284   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
 +
* [[S.japonica_sterols_curated]]
 +
== Reaction(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* [[1.1.1.141-RXN]]
+
* [[RXN-10606]]
* [[1.1.1.145-RXN]]
+
** Category: [[annotation]]
* [[1.1.1.178-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[1.1.1.211-RXN]]
+
* [[RXN-10607]]
* [[1.1.1.8-RXN]]
+
** Category: [[annotation]]
* [[1.2.1.2-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[1.3.1.9-RXN]]
+
* [[RXN-10608]]
* [[1.5.1.11-RXN]]
+
** Category: [[annotation]]
* [[1.5.1.20-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.]]
+
* [[RXN-10609]]
* [[1.6.5.4-RXN]]
+
** Category: [[annotation]]
* [[2KETO-3METHYLVALERATE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]]
+
* [[RXN-10616]]
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
+
** Category: [[annotation]]
* [[ACOAR1h]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ALANINE-DEHYDROGENASE-RXN]]
+
* [[RXN-10617]]
* [[ALCD19]]
+
** Category: [[annotation]]
* [[ALCOHOL-DEHYDROG-GENERIC-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ALCOHOL-DEHYDROG-RXN]]
+
* [[RXN-10618]]
* [[BADH-RXN]]
+
** Category: [[annotation]]
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[CYTOCHROME-B5-REDUCTASE-RXN]]
+
* [[RXN-10619]]
* [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]]
+
** Category: [[annotation]]
* [[DHFOR]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[DHFR2i]]
+
* [[RXN-10784]]
* [[DLACTDEHYDROGNAD-RXN]]
+
** Category: [[annotation]]
* [[ENOYL-ACP-REDUCT-NADH-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ERYTHRULOSE-REDUCTASE-RXN]]
+
* [[RXN-11060]]
* [[FERRIC-CHELATE-REDUCTASE-RXN]]
+
** Category: [[annotation]]
* [[FUMARATE-REDUCTASE-NADH-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[GAPDH_]]
+
* [[RXN-13607]]
* [[GAPOXNPHOSPHN-RXN]]
+
** Category: [[annotation]]
* [[GDR]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[GDRh]]
+
* [[RXN-13608]]
* [[GDRm]]
+
** Category: [[annotation]]
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
+
* [[RXN-14361]]
* [[HACD1h]]
+
** Category: [[annotation]]
* [[HACD2h]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[HACD4h]]
+
* [[RXN-9000]]
* [[HACD5]]
+
** Category: [[annotation]]
* [[HACD5h]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[HACD5m]]
+
* [[RXN66-162]]
* [[HACD6h]]
+
** Category: [[annotation]]
* [[HACD7h]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[HBNOm]]
+
* [[RXN66-168]]
* [[HISTOLDEHYD-RXN]]
+
** Category: [[annotation]]
* [[HMNOS]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[IMP-DEHYDROG-RXN]]
+
* [[RXN66-83]]
* [[KETOGLUTREDUCT-RXN]]
+
** Category: [[annotation]]
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[L-LACTATE-DEHYDROGENASE-RXN]]
+
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
* [[MALATE-DEH-RXN]]
+
** Category: [[annotation]]
* [[MANNITOL-2-DEHYDROGENASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[MANNPDEHYDROG-RXN]]
 
* [[METHANOL-DEHYDROGENASE-RXN]]
 
* [[MTHFD2]]
 
* [[MTHFD2i]]
 
* [[MTHFO]]
 
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
 
* [[NADH-DEHYDROG-A-RXN]]
 
* [[NADH-DEHYDROGENASE-QUINONE-RXN]]
 
* [[NADH-DEHYDROGENASE-RXN]]
 
* [[NADH-KINASE-RXN]]
 
* [[NITRATE-REDUCTASE-NADH-RXN]]
 
* [[NODOx]]
 
* [[PDHe3mr]]
 
* [[PGLYCDEHYDROG-RXN]]
 
* [[R00281]]
 
* [[R230-RXN]]
 
* [[RETINOL-DEHYDROGENASE-RXN]]
 
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
 
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
 
* [[RXN-10057]]
 
* [[RXN-10062]]
 
* [[RXN-10078]]
 
* [[RXN-10079]]
 
* [[RXN-10657]]
 
* [[RXN-10661]]
 
* [[RXN-10781]]
 
* [[RXN-10911]]
 
* [[RXN-10915]]
 
* [[RXN-11195]]
 
* [[RXN-11478]]
 
* [[RXN-11482]]
 
* [[RXN-11662]]
 
* [[RXN-12448]]
 
* [[RXN-12558]]
 
* [[RXN-12559]]
 
* [[RXN-12570]]
 
* [[RXN-12693]]
 
* [[RXN-12701]]
 
* [[RXN-12789]]
 
* [[RXN-12848]]
 
* [[RXN-12849]]
 
* [[RXN-12850]]
 
* [[RXN-12971]]
 
* [[RXN-1302]]
 
* [[RXN-13198]]
 
* [[RXN-13417]]
 
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADH/OXYGEN-MOLECULE/PROTON//CPD-4702/NAD/WATER.76.]]
 
* [[RXN-13712-44-DIMETHYL-824-CHOLESTADIENOL/NADH/OXYGEN-MOLECULE/PROTON//CPD-4577/NAD/WATER.79.]]
 
* [[RXN-13779]]
 
* [[RXN-13927]]
 
* [[RXN-14102]]
 
* [[RXN-14148]]
 
* [[RXN-14271]]
 
* [[RXN-14393]]
 
* [[RXN-161]]
 
* [[RXN-16133]]
 
* [[RXN-16559]]
 
* [[RXN-16620]]
 
* [[RXN-16624]]
 
* [[RXN-16628]]
 
* [[RXN-16632]]
 
* [[RXN-16701]]
 
* [[RXN-17644]]
 
* [[RXN-17653]]
 
* [[RXN-17654]]
 
* [[RXN-17655]]
 
* [[RXN-17884]]
 
* [[RXN-18200]]
 
* [[RXN-18202]]
 
* [[RXN-18204]]
 
* [[RXN-18206]]
 
* [[RXN-18208]]
 
* [[RXN-18210]]
 
* [[RXN-18331]]
 
* [[RXN-3661]]
 
* [[RXN-5424]]
 
* [[RXN-7644]]
 
* [[RXN-7657]]
 
* [[RXN-7693]]
 
* [[RXN-7694]]
 
* [[RXN-7700]]
 
* [[RXN-7706]]
 
* [[RXN-7716]]
 
* [[RXN-7719]]
 
* [[RXN-8629]]
 
* [[RXN-9510]]
 
* [[RXN-9558]]
 
* [[RXN-9635]]
 
* [[RXN-9657]]
 
* [[RXN-9658]]
 
* [[RXN-9659]]
 
* [[RXN-9660]]
 
* [[RXN-9661]]
 
* [[RXN-9662]]
 
* [[RXN-9663]]
 
* [[RXN-9912]]
 
* [[RXN-9914]]
 
* [[RXN0-2044]]
 
* [[RXN0-2145]]
 
* [[RXN0-276]]
 
* [[RXN0-4401]]
 
* [[RXN0-5289]]
 
* [[RXN0-5330]]
 
* [[RXN0-901]]
 
* [[RXN1G-395]]
 
* [[RXN1G-488]]
 
* [[RXN1G-526]]
 
* [[RXN3O-4113]]
 
* [[RXN66-342]]
 
* [[RXN66-350]]
 
* [[RXN66-353]]
 
* [[SALICYLATE-1-MONOOXYGENASE-RXN]]
 
* [[SBTD_D2]]
 
* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 
* [[THFOR1]]
 
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]]
 
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10279/NAD//CPD-14281/NADH/PROTON.37.]]
 
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10280/NAD//CPD-14282/NADH/PROTON.37.]]
 
* [[TRANS-RXN0-277]]
 
 
</div>
 
</div>
== Reaction(s) known to produce the compound ==
+
== Pathway(s) associated ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[PWY-6261]]
* [[1.1.1.141-RXN]]
+
** '''10''' reactions found over '''15''' reactions in the full pathway
* [[1.1.1.145-RXN]]
+
* [[PWY-6313]]
* [[1.1.1.178-RXN]]
+
** '''6''' reactions found over '''7''' reactions in the full pathway
* [[1.1.1.211-RXN]]
+
* [[PWY-6398]]
* [[1.1.1.288-RXN]]
+
** '''5''' reactions found over '''5''' reactions in the full pathway
* [[1.1.1.39-RXN]]
+
* [[PWY-5756]]
* [[1.2.1.2-RXN]]
+
** '''1''' reactions found over '''8''' reactions in the full pathway
* [[1.2.1.25-RXN]]
+
* [[PWY66-221]]
* [[1.2.1.27-RXN]]
+
** '''5''' reactions found over '''18''' reactions in the full pathway
* [[1.3.1.9-RXN]]
+
* [[PWY66-201]]
* [[1.5.1.15-RXN]]
+
** '''3''' reactions found over '''16''' reactions in the full pathway
* [[1.5.1.9-RXN]]
+
{{#set: transcription-direction=positive}}
* [[1.8.1.4-RXN]]
+
{{#set: right-end-position=500469}}
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+
{{#set: left-end-position=447883}}
* [[2KETO-3METHYLVALERATE-RXN]]
+
{{#set: centisome-position=83.82284    }}
* [[2OXOGLUTARATEDEH-RXN]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
* [[3-HYDROXYBUTYRATE-DEHYDROGENASE-RXN]]
+
{{#set: nb reaction associated=18}}
* [[3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN]]
+
{{#set: nb pathway associated=6}}
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
 
* [[4.2.1.93-RXN]]
 
* [[7-ALPHA-HYDROXYSTEROID-DEH-RXN]]
 
* [[ALANINE-DEHYDROGENASE-RXN]]
 
* [[ALCD19]]
 
* [[ALCOHOL-DEHYDROG-GENERIC-RXN]]
 
* [[ALCOHOL-DEHYDROG-RXN]]
 
* [[ALDHDEHYDROG-RXN]]
 
* [[BADH-RXN]]
 
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
 
* [[D-LACTALDEHYDE-DEHYDROGENASE-RXN]]
 
* [[DHBDEHYD-RXN]]
 
* [[DIMETHUROPORDEHYDROG-RXN]]
 
* [[ERYTHRULOSE-REDUCTASE-RXN]]
 
* [[FUMARATE-REDUCTASE-NADH-RXN]]
 
* [[GAPDH_]]
 
* [[GAPOXNPHOSPHN-RXN]]
 
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
 
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 
* [[HACD1h]]
 
* [[HACD2h]]
 
* [[HACD4h]]
 
* [[HACD5]]
 
* [[HACD5h]]
 
* [[HACD5m]]
 
* [[HACD6h]]
 
* [[HACD7h]]
 
* [[HBCO]]
 
* [[HBNOm]]
 
* [[HISTALDEHYD-RXN]]
 
* [[HISTOLDEHYD-RXN]]
 
* [[HMNOS]]
 
* [[IMDH]]
 
* [[IMP-DEHYDROG-RXN]]
 
* [[KETOGLUTREDUCT-RXN]]
 
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
 
* [[L-LACTATE-DEHYDROGENASE-RXN]]
 
* [[MALATE-DEH-RXN]]
 
* [[MANNITOL-2-DEHYDROGENASE-RXN]]
 
* [[MANNPDEHYDROG-RXN]]
 
* [[METHANOL-DEHYDROGENASE-RXN]]
 
* [[MYO-INOSITOL-2-DEHYDROGENASE-RXN]]
 
* [[NADH-DEHYDROG-A-RXN]]
 
* [[NADH-DEHYDROGENASE-RXN]]
 
* [[OHACYL-COA-DEHYDROG-RXN]]
 
* [[PDHe3mr]]
 
* [[PGLYCDEHYDROG-RXN]]
 
* [[PREPHENATEDEHYDROG-RXN]]
 
* [[PYRNUTRANSHYDROGEN-RXN]]
 
* [[PYRROLINECARBDEHYDROG-RXN]]
 
* [[PYRUVDEH-RXN]]
 
* [[R00281]]
 
* [[R222-RXN]]
 
* [[R230-RXN]]
 
* [[RETINOL-DEHYDROGENASE-RXN]]
 
* [[RIBITOL-2-DEHYDROGENASE-RXN]]
 
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
 
* [[RXN-10032]]
 
* [[RXN-10089]]
 
* [[RXN-10698]]
 
* [[RXN-10702]]
 
* [[RXN-10703]]
 
* [[RXN-10715]]
 
* [[RXN-10780]]
 
* [[RXN-10912]]
 
* [[RXN-10915]]
 
* [[RXN-10917]]
 
* [[RXN-11213]]
 
* [[RXN-11245]]
 
* [[RXN-11662]]
 
* [[RXN-11727]]
 
* [[RXN-12107]]
 
* [[RXN-12448]]
 
* [[RXN-12490]]
 
* [[RXN-12507]]
 
* [[RXN-12581]]
 
* [[RXN-12693]]
 
* [[RXN-12705]]
 
* [[RXN-12750]]
 
* [[RXN-12789]]
 
* [[RXN-1302]]
 
* [[RXN-13158]]
 
* [[RXN-13198]]
 
* [[RXN-13414]]
 
* [[RXN-13779]]
 
* [[RXN-13927]]
 
* [[RXN-14102]]
 
* [[RXN-14116]]
 
* [[RXN-14148]]
 
* [[RXN-14224]]
 
* [[RXN-14225]]
 
* [[RXN-14249]]
 
* [[RXN-14271]]
 
* [[RXN-14275]]
 
* [[RXN-14280]]
 
* [[RXN-14393]]
 
* [[RXN-14986]]
 
* [[RXN-16033]]
 
* [[RXN-161]]
 
* [[RXN-16133]]
 
* [[RXN-16559]]
 
* [[RXN-16653]]
 
* [[RXN-16654]]
 
* [[RXN-16655]]
 
* [[RXN-16656]]
 
* [[RXN-16701]]
 
* [[RXN-17777]]
 
* [[RXN-17781]]
 
* [[RXN-17786]]
 
* [[RXN-17790]]
 
* [[RXN-17794]]
 
* [[RXN-17798]]
 
* [[RXN-17808]]
 
* [[RXN-18200]]
 
* [[RXN-18202]]
 
* [[RXN-18204]]
 
* [[RXN-18206]]
 
* [[RXN-18208]]
 
* [[RXN-18210]]
 
* [[RXN-18331]]
 
* [[RXN-1884]]
 
* [[RXN-2902]]
 
* [[RXN-3341]]
 
* [[RXN-3443]]
 
* [[RXN-37]]
 
* [[RXN-4142]]
 
* [[RXN-7644]]
 
* [[RXN-7657]]
 
* [[RXN-7682]]
 
* [[RXN-7693]]
 
* [[RXN-7716]]
 
* [[RXN-7719]]
 
* [[RXN-7745]]
 
* [[RXN-7790]]
 
* [[RXN-8001]]
 
* [[RXN-8582]]
 
* [[RXN-8583]]
 
* [[RXN-8629]]
 
* [[RXN-905]]
 
* [[RXN-9510]]
 
* [[RXN-9758]]
 
* [[RXN-9910]]
 
* [[RXN0-1132]]
 
* [[RXN0-2044]]
 
* [[RXN0-276]]
 
* [[RXN0-5289]]
 
* [[RXN0-901]]
 
* [[RXN66-3]]
 
* [[RXN66-342]]
 
* [[RXN66-350]]
 
* [[RXN66-353]]
 
* [[RXN66-472]]
 
* [[RXN66-476]]
 
* [[RXN66-476-CPD-14719/NAD/WATER//CPD-7830/NADH/PROTON.42.]]
 
* [[RXN66-476-CPD-388/NAD/WATER//CPD-8462/NADH/PROTON.40.]]
 
* [[RXN66-478]]
 
* [[RXN66-479]]
 
* [[RXN6666-5]]
 
* [[RXNQT-4165]]
 
* [[RXNQT-4168]]
 
* [[RXNQT-4171]]
 
* [[RXNQT-4174]]
 
* [[RXNQT-4178]]
 
* [[SSNOm]]
 
* [[SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 
* [[TESTOSTERONE-17-BETA-DEHYDROGENASE-RXN]]
 
* [[THREODEHYD-RXN]]
 
* [[UGD-RXN]]
 
* [[UGDH]]
 
* [[XANDH]]
 
* [[XNDH]]
 
</div>
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=nadh}}
 
{{#set: inchi-key=inchikey=bopgdpnildqyto-nnyoxohssa-l}}
 
{{#set: molecular-weight=663.43}}
 

Revision as of 20:19, 18 December 2020

Gene SJ02722

  • transcription-direction:
    • positive
  • right-end-position:
    • 500469
  • left-end-position:
    • 447883
  • centisome-position:
    • 83.82284

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6261
    • 10 reactions found over 15 reactions in the full pathway
  • PWY-6313
    • 6 reactions found over 7 reactions in the full pathway
  • PWY-6398
    • 5 reactions found over 5 reactions in the full pathway
  • PWY-5756
    • 1 reactions found over 8 reactions in the full pathway
  • PWY66-221
    • 5 reactions found over 18 reactions in the full pathway
  • PWY66-201
    • 3 reactions found over 16 reactions in the full pathway