Difference between revisions of "SJ13939"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P] == * common-name: ** 3...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLETHYLAMINE PHENYLETHYLAMINE] == * common-name: ** 2-phenylethylamine * smiles: ** c([n+])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P 3-DEOXY-D-ARABINO-HEPTULOSONATE-7-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLETHYLAMINE PHENYLETHYLAMINE] ==
 
* common-name:
 
* common-name:
** 3-deoxy-d-arabino-heptulosonate 7-phosphate
+
** 2-phenylethylamine
 
* smiles:
 
* smiles:
** c(=o)([o-])c(=o)cc(o)c(o)c(o)cop([o-])(=o)[o-]
+
** c([n+])cc1(=cc=cc=c1)
 
* inchi-key:
 
* inchi-key:
** pjwipexiffqaqz-pufimzngsa-k
+
** bhhgxplmpwcghp-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 285.124
+
** 122.189
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
+
* [[RXN-10817]]
* [[DAHPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DAHPSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-deoxy-d-arabino-heptulosonate 7-phosphate}}
+
{{#set: common-name=2-phenylethylamine}}
{{#set: inchi-key=inchikey=pjwipexiffqaqz-pufimzngsa-k}}
+
{{#set: inchi-key=inchikey=bhhgxplmpwcghp-uhfffaoysa-o}}
{{#set: molecular-weight=285.124}}
+
{{#set: molecular-weight=122.189}}

Revision as of 09:23, 27 August 2019

Metabolite PHENYLETHYLAMINE

  • common-name:
    • 2-phenylethylamine
  • smiles:
    • c([n+])cc1(=cc=cc=c1)
  • inchi-key:
    • bhhgxplmpwcghp-uhfffaoysa-o
  • molecular-weight:
    • 122.189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality