Difference between revisions of "SJ13948"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NADH-P-OR-NOP NADH-P-OR-NOP] == * common-name: ** nad(p)h == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate * s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate |
| + | * smiles: | ||
| + | ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c | ||
| + | * inchi-key: | ||
| + | ** oplvztyvquwkhb-sdbhatresa-k | ||
| + | * molecular-weight: | ||
| + | ** 572.278 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-4303]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-triphosphate}} |
| + | {{#set: inchi-key=inchikey=oplvztyvquwkhb-sdbhatresa-k}} | ||
| + | {{#set: molecular-weight=572.278}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-4201
- common-name:
- n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
- smiles:
- cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
- inchi-key:
- oplvztyvquwkhb-sdbhatresa-k
- molecular-weight:
- 572.278
