Difference between revisions of "SJ13948"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] == * common-name: ** d-threo-isocitrate * smiles: **...")
(Created page with "Category:gene == Gene SJ13948 == * transcription-direction: ** negative * right-end-position: ** 168536 * left-end-position: ** 146927 * centisome-position: ** 20.235788...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] ==
+
== Gene SJ13948 ==
* common-name:
+
* transcription-direction:
** d-threo-isocitrate
+
** negative
* smiles:
+
* right-end-position:
** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
+
** 168536
* inchi-key:
+
* left-end-position:
** odblhexudapzau-zafykaaxsa-k
+
** 146927
* molecular-weight:
+
* centisome-position:
** 189.101
+
** 20.235788   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ACONITATEHYDR-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[ISOCIT-CLEAV-RXN]]
+
== Reaction(s) associated ==
* [[ISOCITDEH-RXN]]
+
* [[FUCOKINASE-RXN]]
* [[RXN-14047]]
+
** Category: [[annotation]]
* [[RXN-9951]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[biomass_rxn]]
+
** Category: [[orthology]]
== Reaction(s) known to produce the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[ACONITATEHYDR-RXN]]
+
== Pathway(s) associated ==
* [[ISOCIT-CLEAV-RXN]]
+
* [[PWY-6]]
* [[ISOCITDEH-RXN]]
+
** '''1''' reactions found over '''2''' reactions in the full pathway
* [[RXN-14047]]
+
{{#set: transcription-direction=negative}}
* [[RXN-9951]]
+
{{#set: right-end-position=168536}}
== Reaction(s) of unknown directionality ==
+
{{#set: left-end-position=146927}}
{{#set: common-name=d-threo-isocitrate}}
+
{{#set: centisome-position=20.235788    }}
{{#set: inchi-key=inchikey=odblhexudapzau-zafykaaxsa-k}}
+
{{#set: organism associated=S.japonica_sterols_curated}}
{{#set: molecular-weight=189.101}}
+
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ13948

  • transcription-direction:
    • negative
  • right-end-position:
    • 168536
  • left-end-position:
    • 146927
  • centisome-position:
    • 20.235788

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6
    • 1 reactions found over 2 reactions in the full pathway