Difference between revisions of "SJ13970"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-guanine1516 16S-rRNA-guanine1516] == * common-name: ** a guanine1516 in 16s rrna == Re...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide * smil...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide |
+ | * smiles: | ||
+ | ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2)) | ||
+ | * inchi-key: | ||
+ | ** notgfiuvdgnkri-uuokfmhzsa-l | ||
+ | * molecular-weight: | ||
+ | ** 336.197 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[AIAL]] |
+ | * [[AICARSYN-RXN]] | ||
+ | * [[AICARTRANSFORM-RXN]] | ||
+ | * [[FPAIF]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[AIAL]] | ||
+ | * [[AICARSYN-RXN]] | ||
+ | * [[AICARTRANSFORM-RXN]] | ||
+ | * [[FPAIF]] | ||
+ | * [[GLUTAMIDOTRANS-RXN]] | ||
+ | * [[RXN-14270]] | ||
+ | * [[RXN-17900]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide}} |
+ | {{#set: inchi-key=inchikey=notgfiuvdgnkri-uuokfmhzsa-l}} | ||
+ | {{#set: molecular-weight=336.197}} |
Revision as of 09:25, 27 August 2019
Contents
Metabolite AICAR
- common-name:
- 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
- smiles:
- c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
- inchi-key:
- notgfiuvdgnkri-uuokfmhzsa-l
- molecular-weight:
- 336.197