Difference between revisions of "SJ13970"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == * common-name: ** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide * smil...")
(Created page with "Category:gene == Gene SJ13797 == * transcription-direction: ** positive * right-end-position: ** 93472 * left-end-position: ** 84622 * centisome-position: ** 25.631226...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] ==
+
== Gene SJ13797 ==
* common-name:
+
* transcription-direction:
** 5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide
+
** positive
* smiles:
+
* right-end-position:
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n2(c=nc(c(=o)n)=c(n)2))
+
** 93472
* inchi-key:
+
* left-end-position:
** notgfiuvdgnkri-uuokfmhzsa-l
+
** 84622
* molecular-weight:
+
* centisome-position:
** 336.197
+
** 25.631226   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[AIAL]]
+
* [[S.japonica_sterols_curated]]
* [[AICARSYN-RXN]]
+
== Reaction(s) associated ==
* [[AICARTRANSFORM-RXN]]
+
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
* [[FPAIF]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[AIAL]]
+
** Category: [[orthology]]
* [[AICARSYN-RXN]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* [[AICARTRANSFORM-RXN]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* [[FPAIF]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[GLUTAMIDOTRANS-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-14270]]
+
== Pathway(s) associated ==
* [[RXN-17900]]
+
* [[PANTO-PWY]]
== Reaction(s) of unknown directionality ==
+
** '''4''' reactions found over '''4''' reactions in the full pathway
{{#set: common-name=5-amino-1-(5-phospho-d-ribosyl)imidazole-4-carboxamide}}
+
{{#set: transcription-direction=positive}}
{{#set: inchi-key=inchikey=notgfiuvdgnkri-uuokfmhzsa-l}}
+
{{#set: right-end-position=93472}}
{{#set: molecular-weight=336.197}}
+
{{#set: left-end-position=84622}}
 +
{{#set: centisome-position=25.631226    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:23, 18 December 2020

Gene SJ13797

  • transcription-direction:
    • positive
  • right-end-position:
    • 93472
  • left-end-position:
    • 84622
  • centisome-position:
    • 25.631226

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PANTO-PWY
    • 4 reactions found over 4 reactions in the full pathway