Difference between revisions of "SJ13972"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2182 CPD-2182] == * common-name: ** 1-linoleoyl-2-linoleoyl-phosphatidylcholine * smiles: *...")
(Created page with "Category:gene == Gene SJ09795 == * transcription-direction: ** positive * right-end-position: ** 5504 * left-end-position: ** 4252 * centisome-position: ** 11.575108 =...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2182 CPD-2182] ==
+
== Gene SJ09795 ==
−
* common-name:
+
* transcription-direction:
−
** 1-linoleoyl-2-linoleoyl-phosphatidylcholine
+
** positive
−
* smiles:
+
* right-end-position:
−
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** 5504
−
* inchi-key:
+
* left-end-position:
−
** fvxdqwzbhixiej-lndkuqbdsa-n
+
** 4252
−
* molecular-weight:
+
* centisome-position:
−
** 782.092
+
** 11.575108   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-8323]]
+
* [[S.japonica_sterols_curated]]
−
* [[RXN-8329]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3.1.26.4-RXN]]
−
* [[RXN-8322]]
+
** Category: [[annotation]]
−
* [[RXN-8328]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
{{#set: common-name=1-linoleoyl-2-linoleoyl-phosphatidylcholine}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=fvxdqwzbhixiej-lndkuqbdsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=782.092}}
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=5504}}
 +
{{#set: left-end-position=4252}}
 +
{{#set: centisome-position=11.575108    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}

Revision as of 20:20, 18 December 2020

Gene SJ09795

  • transcription-direction:
    • positive
  • right-end-position:
    • 5504
  • left-end-position:
    • 4252
  • centisome-position:
    • 11.575108

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ13972&oldid=41076"