Difference between revisions of "SJ13978"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GTP GTP] == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc...")
(Created page with "Category:gene == Gene SJ13978 == * transcription-direction: ** negative * right-end-position: ** 701973 * left-end-position: ** 693897 * centisome-position: ** 95.56823...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GTP GTP] ==
+
== Gene SJ13978 ==
* common-name:
+
* transcription-direction:
** gtp
+
** negative
* smiles:
+
* right-end-position:
** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** 701973
* inchi-key:
+
* left-end-position:
** xkmlyualxhknft-uuokfmhzsa-j
+
** 693897
* molecular-weight:
+
* centisome-position:
** 519.151
+
** 95.56823   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[S.japonica_carotenoid_curated]]
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
== Reaction(s) associated ==
* [[FE2GTPabc]]
+
* [[GSAAMINOTRANS-RXN]]
* [[GTCY]]
+
** Category: [[annotation]]
* [[GTP-CYCLOHYDRO-I-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[GTP-CYCLOHYDRO-II-RXN]]
+
** Category: [[orthology]]
* [[GTPPYPHOSKIN-RXN]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* [[GTUP]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[GUANYLCYC-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
+
== Pathway(s) associated ==
* [[NTDP]]
+
* [[PWY-5188]]
* [[RXN-12502]]
+
** '''6''' reactions found over '''6''' reactions in the full pathway
* [[RXN-12504]]
+
{{#set: transcription-direction=negative}}
* [[RXN-14140]]
+
{{#set: right-end-position=701973}}
* [[RXN-14201]]
+
{{#set: left-end-position=693897}}
* [[RXN-15713]]
+
{{#set: centisome-position=95.56823    }}
* [[RXN-17921]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[RXN-8340]]
+
{{#set: nb reaction associated=1}}
* [[RXN-8988]]
+
{{#set: nb pathway associated=1}}
* [[RXN0-5462]]
 
* [[RXN0-746]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
* [[URKI-RXN]]
 
</div>
 
== Reaction(s) known to produce the compound ==
 
* [[3.6.1.17-RXN]]
 
* [[ATGD]]
 
* [[GDPKIN-RXN]]
 
* [[GTPOP]]
 
* [[RXN-14117]]
 
* [[RXN0-6427]]
 
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=gtp}}
 
{{#set: inchi-key=inchikey=xkmlyualxhknft-uuokfmhzsa-j}}
 
{{#set: molecular-weight=519.151}}
 

Latest revision as of 11:03, 18 March 2021

Gene SJ13978

  • transcription-direction:
    • negative
  • right-end-position:
    • 701973
  • left-end-position:
    • 693897
  • centisome-position:
    • 95.56823

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5188
    • 6 reactions found over 6 reactions in the full pathway