Difference between revisions of "SJ13978"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GTP GTP] == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTANEDIOL BUTANEDIOL] == * common-name: ** (r,r)-2,3-butanediol * smiles: ** cc(c(o)c)o * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GTP GTP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTANEDIOL BUTANEDIOL] ==
 
* common-name:
 
* common-name:
−
** gtp
+
** (r,r)-2,3-butanediol
 
* smiles:
 
* smiles:
−
** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+
** cc(c(o)c)o
 
* inchi-key:
 
* inchi-key:
−
** xkmlyualxhknft-uuokfmhzsa-j
+
** owbtypjtuoewek-qwwzwvqmsa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 519.151
+
** 90.122
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
−
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
 
−
* [[FE2GTPabc]]
 
−
* [[GTCY]]
 
−
* [[GTP-CYCLOHYDRO-I-RXN]]
 
−
* [[GTP-CYCLOHYDRO-II-RXN]]
 
−
* [[GTPPYPHOSKIN-RXN]]
 
−
* [[GTUP]]
 
−
* [[GUANYLCYC-RXN]]
 
−
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 
−
* [[NTDP]]
 
−
* [[RXN-12502]]
 
−
* [[RXN-12504]]
 
−
* [[RXN-14140]]
 
−
* [[RXN-14201]]
 
−
* [[RXN-15713]]
 
−
* [[RXN-17921]]
 
−
* [[RXN-8340]]
 
−
* [[RXN-8988]]
 
−
* [[RXN0-5462]]
 
−
* [[RXN0-746]]
 
−
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
−
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
−
* [[URKI-RXN]]
 
−
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[3.6.1.17-RXN]]
+
* [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]]
−
* [[ATGD]]
 
−
* [[GDPKIN-RXN]]
 
−
* [[GTPOP]]
 
−
* [[RXN-14117]]
 
−
* [[RXN0-6427]]
 
−
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 
−
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=gtp}}
+
{{#set: common-name=(r,r)-2,3-butanediol}}
−
{{#set: inchi-key=inchikey=xkmlyualxhknft-uuokfmhzsa-j}}
+
{{#set: inchi-key=inchikey=owbtypjtuoewek-qwwzwvqmsa-n}}
−
{{#set: molecular-weight=519.151}}
+
{{#set: molecular-weight=90.122}}

Revision as of 09:24, 27 August 2019

Metabolite BUTANEDIOL

  • common-name:
    • (r,r)-2,3-butanediol
  • smiles:
    • cc(c(o)c)o
  • inchi-key:
    • owbtypjtuoewek-qwwzwvqmsa-n
  • molecular-weight:
    • 90.122

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ13978&oldid=28869"