Difference between revisions of "SJ14012"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ALL-TRANS-HEXAPRENYL-DIPHOSPHATE] == * common-name: ** all-tra...")
 
(Created page with "Category:gene == Gene SJ14012 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ALL-TRANS-HEXAPRENYL-DIPHOSPHATE] ==
+
== Gene SJ14012 ==
−
* common-name:
+
== Organism(s) associated with this gene  ==
−
** all-trans-hexaprenyl diphosphate
+
* [[S.japonica_carotenoid_curated]]
−
* smiles:
+
== Reaction(s) associated ==
−
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+
* [[4.2.2.10-RXN]]
−
* inchi-key:
+
** Category: [[orthology]]
−
** ngfsmhkftzrokj-mmszmyibsa-k
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* molecular-weight:
+
* [[5.99.1.3-RXN]]
−
** 583.66
+
** Category: [[orthology]]
−
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[RXN-9003]]
+
* [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[orthology]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
{{#set: common-name=all-trans-hexaprenyl diphosphate}}
+
* [[RXN-14897]]
−
{{#set: inchi-key=inchikey=ngfsmhkftzrokj-mmszmyibsa-k}}
+
** Category: [[orthology]]
−
{{#set: molecular-weight=583.66}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7243]]
 +
** '''1''' reactions found over '''n.a''' reactions in the full pathway
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ14012

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7243
    • 1 reactions found over n.a reactions in the full pathway


Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ14012&oldid=133106"