Difference between revisions of "SJ14026"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unspecified-Degradation-Products Unspecified-Degradation-Products] == * common-name: ** [unspec...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * common-name: ** (s)-malate * smiles: ** c(=o)([o-])cc(o)c([o-])=o * inchi-key: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == |
* common-name: | * common-name: | ||
− | ** [ | + | ** (s)-malate |
+ | * smiles: | ||
+ | ** c(=o)([o-])cc(o)c([o-])=o | ||
+ | * inchi-key: | ||
+ | ** bjepykjpyrnkow-reohclbhsa-l | ||
+ | * molecular-weight: | ||
+ | ** 132.073 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[1.1.1.39-RXN]] | ||
+ | * [[FUMHYDR-RXN]] | ||
+ | * [[MALATE-DEH-RXN]] | ||
+ | * [[MALIC-NADP-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[FUMHYDR-RXN]] |
− | * [[RXN- | + | * [[MALATE-DEH-RXN]] |
+ | * [[MALATE-DEHYDROGENASE-NADP+-RXN]] | ||
+ | * [[MALSYN-RXN]] | ||
+ | * [[RXN-14937]] | ||
+ | * [[RXN-6002]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(s)-malate}} |
+ | {{#set: inchi-key=inchikey=bjepykjpyrnkow-reohclbhsa-l}} | ||
+ | {{#set: molecular-weight=132.073}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite MAL
- common-name:
- (s)-malate
- smiles:
- c(=o)([o-])cc(o)c([o-])=o
- inchi-key:
- bjepykjpyrnkow-reohclbhsa-l
- molecular-weight:
- 132.073