Difference between revisions of "SJ14051"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-HYDROXY-PHENYLPYRUVATE P-HYDROXY-PHENYLPYRUVATE] == * common-name: ** 4-hydroxyphenylpyruvate...")
(Created page with "Category:gene == Gene SJ14051 == * transcription-direction: ** negative * right-end-position: ** 324250 * left-end-position: ** 296527 * centisome-position: ** 90.63559...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-HYDROXY-PHENYLPYRUVATE P-HYDROXY-PHENYLPYRUVATE] ==
+
== Gene SJ14051 ==
−
* common-name:
+
* transcription-direction:
−
** 4-hydroxyphenylpyruvate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o)
+
** 324250
−
* inchi-key:
+
* left-end-position:
−
** kkadpxvioxhvkn-uhfffaoysa-m
+
** 296527
−
* molecular-weight:
+
* centisome-position:
−
** 179.152
+
** 90.63559   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[HPPD]]
+
== Reaction(s) associated ==
−
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[PREPHENATEDEHYDROG-RXN]]
+
== Pathway(s) associated ==
−
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
+
* [[PWY-7511]]
−
== Reaction(s) of unknown directionality ==
+
** '''7''' reactions found over '''9''' reactions in the full pathway
−
{{#set: common-name=4-hydroxyphenylpyruvate}}
+
{{#set: transcription-direction=negative}}
−
{{#set: inchi-key=inchikey=kkadpxvioxhvkn-uhfffaoysa-m}}
+
{{#set: right-end-position=324250}}
−
{{#set: molecular-weight=179.152}}
+
{{#set: left-end-position=296527}}
 +
{{#set: centisome-position=90.63559    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ14051

  • transcription-direction:
    • negative
  • right-end-position:
    • 324250
  • left-end-position:
    • 296527
  • centisome-position:
    • 90.63559

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ14051&oldid=133083"