Difference between revisions of "SJ14051"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-HYDROXY-PHENYLPYRUVATE P-HYDROXY-PHENYLPYRUVATE] == * common-name: ** 4-hydroxyphenylpyruvate...")
(Created page with "Category:gene == Gene SJ00174 == * transcription-direction: ** positive * right-end-position: ** 65066 * left-end-position: ** 60516 * centisome-position: ** 35.45292...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-HYDROXY-PHENYLPYRUVATE P-HYDROXY-PHENYLPYRUVATE] ==
+
== Gene SJ00174 ==
* common-name:
+
* transcription-direction:
** 4-hydroxyphenylpyruvate
+
** positive
* smiles:
+
* right-end-position:
** c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o)
+
** 65066
* inchi-key:
+
* left-end-position:
** kkadpxvioxhvkn-uhfffaoysa-m
+
** 60516
* molecular-weight:
+
* centisome-position:
** 179.152
+
** 35.45292   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[HPPD]]
+
== Reaction(s) associated ==
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
+
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[PREPHENATEDEHYDROG-RXN]]
+
** Category: [[orthology]]
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
{{#set: transcription-direction=positive}}
{{#set: common-name=4-hydroxyphenylpyruvate}}
+
{{#set: right-end-position=65066}}
{{#set: inchi-key=inchikey=kkadpxvioxhvkn-uhfffaoysa-m}}
+
{{#set: left-end-position=60516}}
{{#set: molecular-weight=179.152}}
+
{{#set: centisome-position=35.45292    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:22, 18 December 2020

Gene SJ00174

  • transcription-direction:
    • positive
  • right-end-position:
    • 65066
  • left-end-position:
    • 60516
  • centisome-position:
    • 35.45292

Organism(s) associated with this gene

Reaction(s) associated