Difference between revisions of "SJ14111"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3...")
(Created page with "Category:gene == Gene SJ11352 == * transcription-direction: ** negative * right-end-position: ** 64115 * left-end-position: ** 51986 * centisome-position: ** 13.92338...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] ==
+
== Gene SJ11352 ==
−
* common-name:
+
* transcription-direction:
−
** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
+
** 64115
−
* inchi-key:
+
* left-end-position:
−
** acivvgbvovhfpq-rpdrrwsusa-l
+
** 51986
−
* molecular-weight:
+
* centisome-position:
−
** 353.228
+
** 13.92338   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-14171]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-10057]]
+
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
−
* [[RXN-14171]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one}}
+
** Category: [[orthology]]
−
{{#set: inchi-key=inchikey=acivvgbvovhfpq-rpdrrwsusa-l}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
{{#set: molecular-weight=353.228}}
+
* [[RXN-17203]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-18301]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-18303]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7840]]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=64115}}
 +
{{#set: left-end-position=51986}}
 +
{{#set: centisome-position=13.92338    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=4}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ11352

  • transcription-direction:
    • negative
  • right-end-position:
    • 64115
  • left-end-position:
    • 51986
  • centisome-position:
    • 13.92338

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7840
    • 3 reactions found over 5 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ14111&oldid=41535"