Difference between revisions of "SJ14111"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3707 CPD-3707] == * common-name: ** adenosine 2',3'-cyclic monophosphate * smiles: ** c4(n=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3707 CPD-3707] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] ==
 
* common-name:
 
* common-name:
** adenosine 2',3'-cyclic monophosphate
+
** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
 
* smiles:
 
* smiles:
** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n))
+
** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** kmywvddipvnlme-kqynxxcusa-m
+
** acivvgbvovhfpq-rpdrrwsusa-l
 
* molecular-weight:
 
* molecular-weight:
** 328.201
+
** 353.228
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12057]]
+
* [[RXN-14171]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10057]]
 +
* [[RXN-14171]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one}}
{{#set: inchi-key=inchikey=kmywvddipvnlme-kqynxxcusa-m}}
+
{{#set: inchi-key=inchikey=acivvgbvovhfpq-rpdrrwsusa-l}}
{{#set: molecular-weight=328.201}}
+
{{#set: molecular-weight=353.228}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-10809

  • common-name:
    • 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
  • smiles:
    • c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
  • inchi-key:
    • acivvgbvovhfpq-rpdrrwsusa-l
  • molecular-weight:
    • 353.228

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality