Difference between revisions of "SJ14115"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] == * common-name: ** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquin...")
 
(Created page with "Category:gene == Gene SJ14115 == * transcription-direction: ** negative * right-end-position: ** 152505 * left-end-position: ** 142180 * centisome-position: ** 43.726704...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9871 CPD-9871] ==
+
== Gene SJ14115 ==
* common-name:
+
* transcription-direction:
** 6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol
+
** negative
* smiles:
+
* right-end-position:
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c)c
+
** 152505
* inchi-key:
+
* left-end-position:
** xcoxsblqzpfvgk-rgiwonjesa-n
+
** 142180
* molecular-weight:
+
* centisome-position:
** 835.347
+
** 43.726704   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-9235]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-decaprenyl-1,4-benzoquinol}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=xcoxsblqzpfvgk-rgiwonjesa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=835.347}}
+
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=152505}}
 +
{{#set: left-end-position=142180}}
 +
{{#set: centisome-position=43.726704    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ14115

  • transcription-direction:
    • negative
  • right-end-position:
    • 152505
  • left-end-position:
    • 142180
  • centisome-position:
    • 43.726704

Organism(s) associated with this gene

Reaction(s) associated