Difference between revisions of "SJ14115"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] == * common-name: ** udp-α-d-glucuronate * smiles: ** c(...")
(Created page with "Category:gene == Gene SJ18863 == * transcription-direction: ** negative * right-end-position: ** 98043 * left-end-position: ** 74801 * centisome-position: ** 31.829807...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-GLUCURONATE UDP-GLUCURONATE] ==
+
== Gene SJ18863 ==
* common-name:
+
* transcription-direction:
** udp-α-d-glucuronate
+
** negative
* smiles:
+
* right-end-position:
** c(c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))op(=o)([o-])op(=o)([o-])oc3(oc(c([o-])=o)c(o)c(o)c(o)3)
+
** 98043
* inchi-key:
+
* left-end-position:
** hdyanyhvcapmjv-lxqifkjmsa-k
+
** 74801
* molecular-weight:
+
* centisome-position:
** 577.265
+
** 31.829807   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[S.japonica_sterols_curated]]
* [[2.4.1.212-RXN]]
+
== Reaction(s) associated ==
* [[2.4.1.225-RXN]]
+
* [[DIHYDRODIPICSYN-RXN]]
* [[2.7.7.44-RXN]]
+
** Category: [[annotation]]
* [[RXN-10606]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-10607]]
+
== Pathway(s) associated ==
* [[RXN-10608]]
+
* [[PWY-5097]]
* [[RXN-10609]]
+
** '''7''' reactions found over '''7''' reactions in the full pathway
* [[RXN-10616]]
+
* [[DAPLYSINESYN-PWY]]
* [[RXN-10617]]
+
** '''7''' reactions found over '''9''' reactions in the full pathway
* [[RXN-10618]]
+
* [[PWY-2941]]
* [[RXN-10619]]
+
** '''6''' reactions found over '''9''' reactions in the full pathway
* [[RXN-10784]]
+
* [[PWY-2942]]
* [[RXN-11060]]
+
** '''6''' reactions found over '''7''' reactions in the full pathway
* [[RXN-13607]]
+
{{#set: transcription-direction=negative}}
* [[RXN-13608]]
+
{{#set: right-end-position=98043}}
* [[RXN-14361]]
+
{{#set: left-end-position=74801}}
* [[RXN-9000]]
+
{{#set: centisome-position=31.829807    }}
* [[RXN66-162]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
* [[RXN66-168]]
+
{{#set: nb reaction associated=1}}
* [[RXN66-83]]
+
{{#set: nb pathway associated=4}}
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
* [[UDP-GLUCURONATE-DECARBOXYLASE-RXN]]
 
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
* [[UGDC]]
 
</div>
 
== Reaction(s) known to produce the compound ==
 
* [[2.7.7.44-RXN]]
 
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
* [[UGD-RXN]]
 
* [[UGDH]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=udp-&alpha;-d-glucuronate}}
 
{{#set: inchi-key=inchikey=hdyanyhvcapmjv-lxqifkjmsa-k}}
 
{{#set: molecular-weight=577.265}}
 

Revision as of 20:22, 18 December 2020

Gene SJ18863

  • transcription-direction:
    • negative
  • right-end-position:
    • 98043
  • left-end-position:
    • 74801
  • centisome-position:
    • 31.829807

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5097
    • 7 reactions found over 7 reactions in the full pathway
  • DAPLYSINESYN-PWY
    • 7 reactions found over 9 reactions in the full pathway
  • PWY-2941
    • 6 reactions found over 9 reactions in the full pathway
  • PWY-2942
    • 6 reactions found over 7 reactions in the full pathway