Difference between revisions of "SJ14159"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PLASTOQUINONE PLASTOQUINONE] == * common-name: ** a plastoquinone == Reaction(s) known to consu...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-7-DIMETHYLXANTHINE 3-7-DIMETHYLXANTHINE] == * common-name: ** theobromine * smiles: ** cn2(c=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PLASTOQUINONE PLASTOQUINONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-7-DIMETHYLXANTHINE 3-7-DIMETHYLXANTHINE] ==
 
* common-name:
 
* common-name:
** a plastoquinone
+
** theobromine
 +
* smiles:
 +
** cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
 +
* inchi-key:
 +
** yapqbxqyljrxsa-uhfffaoysa-n
 +
* molecular-weight:
 +
** 180.166
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PSII-RXN]]
+
* [[RXN-11519]]
* [[RXN-11355]]
 
* [[RXN-12243]]
 
* [[RXN-12244]]
 
* [[RXN-12303]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12303]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a plastoquinone}}
+
{{#set: common-name=theobromine}}
 +
{{#set: inchi-key=inchikey=yapqbxqyljrxsa-uhfffaoysa-n}}
 +
{{#set: molecular-weight=180.166}}

Revision as of 14:19, 26 August 2019

Metabolite 3-7-DIMETHYLXANTHINE

  • common-name:
    • theobromine
  • smiles:
    • cn2(c=nc1(=c(c(nc(n(c)1)=o)=o)2))
  • inchi-key:
    • yapqbxqyljrxsa-uhfffaoysa-n
  • molecular-weight:
    • 180.166

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality