Difference between revisions of "SJ14186"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * common-name: ** docosahexaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc...")
(Created page with "Category:gene == Gene SJ16286 == * transcription-direction: ** positive * right-end-position: ** 257237 * left-end-position: ** 219438 * centisome-position: ** 76.8876...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] ==
+
== Gene SJ16286 ==
* common-name:
+
* transcription-direction:
** docosahexaenoate
+
** positive
* smiles:
+
* right-end-position:
** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-]
+
** 257237
* inchi-key:
+
* left-end-position:
** mbmbgcfofbjsgt-kubavdmbsa-m
+
** 219438
* molecular-weight:
+
* centisome-position:
** 327.486
+
** 76.8876   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-16063]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-16017]]
+
* [[3.1.3.46-RXN]]
* [[RXN-16063]]
+
** Category: [[orthology]]
* [[RXN-16138]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
{{#set: common-name=docosahexaenoate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=mbmbgcfofbjsgt-kubavdmbsa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=327.486}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY66-423]]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=257237}}
 +
{{#set: left-end-position=219438}}
 +
{{#set: centisome-position=76.8876    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:22, 18 December 2020

Gene SJ16286

  • transcription-direction:
    • positive
  • right-end-position:
    • 257237
  • left-end-position:
    • 219438
  • centisome-position:
    • 76.8876

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY66-423
    • 2 reactions found over 2 reactions in the full pathway