Difference between revisions of "SJ14191"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-30 CPDQT-30] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE] ==
 * common-name:
-** 9-(methylthio)-2-oxononanoate
+** 6-(hydroxymethyl)-7,8-dihydropterin
 * smiles:
-** cscccccccc(=o)c([o-])=o
+** c(o)c2(=nc1(c(=o)nc(n)=nc=1nc2))
 * inchi-key:
-** mjgxiouqxyxglp-uhfffaoysa-m
+** cqqnnqtxugluev-uhfffaoysa-n
 * molecular-weight:
-** 217.302
+** 195.18
 == Reaction(s) known to consume the compound ==
+* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXNQT-4174]]
+* [[H2NEOPTERINALDOL-RXN]]
+* [[RXN-10857]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=9-(methylthio)-2-oxononanoate}}
+{{#set: common-name=6-(hydroxymethyl)-7,8-dihydropterin}}
-{{#set: inchi-key=inchikey=mjgxiouqxyxglp-uhfffaoysa-m}}
+{{#set: inchi-key=inchikey=cqqnnqtxugluev-uhfffaoysa-n}}
-{{#set: molecular-weight=217.302}}
+{{#set: molecular-weight=195.18}}