Difference between revisions of "SJ14335"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9858 CPD-9858] == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smi...")
 
(Created page with "Category:gene == Gene SJ14335 == * transcription-direction: ** positive * right-end-position: ** 176559 * left-end-position: ** 155307 * centisome-position: ** 48.65096...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9858 CPD-9858] ==
+
== Gene SJ14335 ==
* common-name:
+
* transcription-direction:
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
+
** positive
* smiles:
+
* right-end-position:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
+
** 176559
* inchi-key:
+
* left-end-position:
** wegxyvfdoluulo-tuumqracsa-n
+
** 155307
* molecular-weight:
+
* centisome-position:
** 616.966
+
** 48.65096   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-9227]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=616.966}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=176559}}
 +
{{#set: left-end-position=155307}}
 +
{{#set: centisome-position=48.65096    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ14335

  • transcription-direction:
    • positive
  • right-end-position:
    • 176559
  • left-end-position:
    • 155307
  • centisome-position:
    • 48.65096

Organism(s) associated with this gene

Reaction(s) associated