Difference between revisions of "SJ14335"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9858 CPD-9858] == * common-name: ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol * smi...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L- 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-] == * common-name: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9858 CPD-9858] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L- 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-] ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
+
** a 2-[(3s)-3-carboxy-3-(methylammonio)propyl]-l-histidine-[translation elongation factor 2]
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c)c
 
* inchi-key:
 
** wegxyvfdoluulo-tuumqracsa-n
 
* molecular-weight:
 
** 616.966
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9227]]
+
* [[RXN-11374]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11370]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=a 2-[(3s)-3-carboxy-3-(methylammonio)propyl]-l-histidine-[translation elongation factor 2]}}
{{#set: inchi-key=inchikey=wegxyvfdoluulo-tuumqracsa-n}}
 
{{#set: molecular-weight=616.966}}
 

Revision as of 14:19, 26 August 2019

Metabolite 2-3-CARBOXY-3-METHYLAMMONIOPROPYL-L-

  • common-name:
    • a 2-[(3s)-3-carboxy-3-(methylammonio)propyl]-l-histidine-[translation elongation factor 2]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 2-[(3s)-3-carboxy-3-(methylammonio)propyl]-l-histidine-[translation elongation factor 2" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.