Difference between revisions of "SJ14336"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == * common-name: ** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14760 CPD-14760] == * common-name: ** furfuryl methyl sulfide * smiles: ** cscc1(=cc=co1) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14760 CPD-14760] ==
 
* common-name:
 
* common-name:
** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
+
** furfuryl methyl sulfide
 
* smiles:
 
* smiles:
** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
+
** cscc1(=cc=co1)
 
* inchi-key:
 
* inchi-key:
** cwvrqjbcbctflt-civpzrojsa-n
+
** sksfhxvdhvkibn-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 488.442
+
** 128.189
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12270]]
+
* [[RXN-13727]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp}}
+
{{#set: common-name=furfuryl methyl sulfide}}
{{#set: inchi-key=inchikey=cwvrqjbcbctflt-civpzrojsa-n}}
+
{{#set: inchi-key=inchikey=sksfhxvdhvkibn-uhfffaoysa-n}}
{{#set: molecular-weight=488.442}}
+
{{#set: molecular-weight=128.189}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-14760

  • common-name:
    • furfuryl methyl sulfide
  • smiles:
    • cscc1(=cc=co1)
  • inchi-key:
    • sksfhxvdhvkibn-uhfffaoysa-n
  • molecular-weight:
    • 128.189

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality